FIELD: agriculture. SUBSTANCE: this herbicidal composition includes compound (I) ZSO2NHCON(M)Het, where Z-ZQ-C6H4, 2-COOCH3C6H4CH2, 3-L-C5H4N, CH3SO2N(CH3), N(CH3)-N=CH-C(COOC2H5)=C-,C-, and M represent hydrogen or methyl and Q-OCH2CH2Cl, CH2CH2CF3, COOCH3, COOC2H5, OCH2CH2OCH3, L-CON(CH3)2, CH3, E-N= or -C= and X-OCH3,OCHF2,X1-OCH3 and OCHF2, and compound of formula (II), where Y is SCH2COOCH3 and COSCH(CH3)COOCH2CH2OC2H5 at mass ratio of 1 15 1 8. EFFECT: high herbicidal properties. 9 cl
