FIELD: chemistry.
SUBSTANCE: present invention relates to a method for synthesis of methanol from natural gas which contains light hydrocarbons involving the following steps: - extraction of natural gas which contains light hydrocarbons from incoming hydrocarbon gas; -reaction of light hydrocarbons from the natural gas with oxygen, resulting in formation of a synthetic gas-containing intermediate reaction product at over 60 atm pressure through a synthetic gas formation reaction, where the synthetic gas formation reaction involves gasification; -reaction of at least a portion of the intermediate reaction product to form methanol through a methanol formation reaction, and H2-containing exhaust gas; -outlet of methanol and the exhaust gas through a methanol outlet and an exhaust gas outlet after the methanol formation reaction; -separation of H2 from at least a portion of the exhaust gas via a pressure fluctuation dampening process, resulting in formation of hydrogen at over 60 atm pressure; -feeding the separated H2 into the gas stream passing through the hydrocarbon gas inlet and the methanol outlet, where H2, separated via the pressure fluctuation dampening process, is fed into the synthetic gas-containing intermediate reaction product before carrying out the methanol formation reaction, resulting in a synthetic gas composition with stoichiometric number (SN)>2, expressed in molar content of [H2], [CO] and [CO2], SN=[H2]-[CO2]/([CO]+[CO2]).
EFFECT: invention enables synthesis of methanol using a simple and efficient method.
5 cl, 2 tbl, 3 dwg
