FIELD: organic chemistry, antibiotics. SUBSTANCE: invention relates to new compounds of secomacrolides and secoazalides class - potential intermediate compounds used for synthesis of new macrolide and azalide antibiotics and to a method of their synthesis and intermediate compounds for their synthesis. Invention describes 9a-azalide fragments of macrolide antibiotics of an azalide class of the general formula (I) 
where R1 and R2 are similar and mean H or CH3; R3 and R4 are distinct and mean H or CH3; Y means O when Z means CH3 and Y means NH when Z means CH(CH3)CH(OH)COH(CH3)CH(OH)C2H5 or their pharmaceutically acceptable salts of inorganic or organic acids. EFFECT: new compounds indicated above, improved method of synthesis. 39 cl, 22 ex
